C27H23FN4O2 — CID 92990695
3-(4-fluorophenyl)-7-[(1R)-1-phenylethyl]-1-(2-phenylethyl)purine-2,6-dione (PubChem CID 92990695) has the molecular formula C27H23FN4O2 and a molecular weight of 454.51 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-7-[(1R)-1-phenylethyl]-1-(2-phenylethyl)purine-2,6-dione.
| Compound Name | 3-(4-fluorophenyl)-7-[(1R)-1-phenylethyl]-1-(2-phenylethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 92990695 |
| Molecular Formula | C27H23FN4O2 |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 3-(4-fluorophenyl)-7-[(1R)-1-phenylethyl]-1-(2-phenylethyl)purine-2,6-dione |
| SMILES | C[C@H](c1ccccc1)n1cnc2c1c(=O)n(CCc1ccccc1)c(=O)n2-c1ccc(F)cc1 |
| InChI | InChI=1S/C27H23FN4O2/c1-19(21-10-6-3-7-11-21)31-18-29-25-24(31)26(33)30(17-16-20-8-4-2-5-9-20)27(34)32(25)23-14-12-22(28)13-15-23/h2-15,18-19H,16-17H2,1H3/t19-/m1/s1 |
| InChIKey | PUEUIQORRZPOLO-LJQANCHMSA-N |
| XLogP | 4.34 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |