C26H21FN4O2 — CID 92990690
1-benzyl-3-(4-fluorophenyl)-7-[(1S)-1-phenylethyl]purine-2,6-dione (PubChem CID 92990690) has the molecular formula C26H21FN4O2 and a molecular weight of 440.48 g/mol. Its IUPAC name is 1-benzyl-3-(4-fluorophenyl)-7-[(1S)-1-phenylethyl]purine-2,6-dione.
| Compound Name | 1-benzyl-3-(4-fluorophenyl)-7-[(1S)-1-phenylethyl]purine-2,6-dione |
|---|---|
| PubChem CID | 92990690 |
| Molecular Formula | C26H21FN4O2 |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 1-benzyl-3-(4-fluorophenyl)-7-[(1S)-1-phenylethyl]purine-2,6-dione |
| SMILES | C[C@@H](c1ccccc1)n1cnc2c1c(=O)n(Cc1ccccc1)c(=O)n2-c1ccc(F)cc1 |
| InChI | InChI=1S/C26H21FN4O2/c1-18(20-10-6-3-7-11-20)30-17-28-24-23(30)25(32)29(16-19-8-4-2-5-9-19)26(33)31(24)22-14-12-21(27)13-15-22/h2-15,17-18H,16H2,1H3/t18-/m0/s1 |
| InChIKey | CKYLSSGPUIMWGX-SFHVURJKSA-N |
| XLogP | 4.15 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |