C26H26N4O4 — CID 92999493
4-methyl-3-nitro-N-[4-[2-oxo-3-[(1R)-1-phenylethyl]-1,3-diazinan-1-yl]phenyl]benzamide (PubChem CID 92999493) has the molecular formula C26H26N4O4 and a molecular weight of 458.52 g/mol. Its IUPAC name is 4-methyl-3-nitro-N-[4-[2-oxo-3-[(1R)-1-phenylethyl]-1,3-diazinan-1-yl]phenyl]benzamide.
| Compound Name | 4-methyl-3-nitro-N-[4-[2-oxo-3-[(1R)-1-phenylethyl]-1,3-diazinan-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 92999493 |
| Molecular Formula | C26H26N4O4 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 4-methyl-3-nitro-N-[4-[2-oxo-3-[(1R)-1-phenylethyl]-1,3-diazinan-1-yl]phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(N3CCCN([C@H](C)c4ccccc4)C3=O)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H26N4O4/c1-18-9-10-21(17-24(18)30(33)34)25(31)27-22-11-13-23(14-12-22)29-16-6-15-28(26(29)32)19(2)20-7-4-3-5-8-20/h3-5,7-14,17,19H,6,15-16H2,1-2H3,(H,27,31)/t19-/m1/s1 |
| InChIKey | QYQPJINNRILNNT-LJQANCHMSA-N |
| XLogP | 5.55 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|