C27H27N3O3S — CID 93009123
[(3R,3aS,7Z)-3-(4-methoxyphenyl)-7-[(4-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-methyl-1,3-thiazol-5-yl)methanone (PubChem CID 93009123) has the molecular formula C27H27N3O3S and a molecular weight of 473.60 g/mol. Its IUPAC name is [(3R,3aS,7Z)-3-(4-methoxyphenyl)-7-[(4-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-methyl-1,3-thiazol-5-yl)methanone.
| Compound Name | [(3R,3aS,7Z)-3-(4-methoxyphenyl)-7-[(4-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-methyl-1,3-thiazol-5-yl)methanone |
|---|---|
| PubChem CID | 93009123 |
| Molecular Formula | C27H27N3O3S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | [(3R,3aS,7Z)-3-(4-methoxyphenyl)-7-[(4-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-methyl-1,3-thiazol-5-yl)methanone |
| SMILES | COc1ccc(/C=C2/CCC[C@@H]3C2=NN(C(=O)c2scnc2C)[C@H]3c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C27H27N3O3S/c1-17-26(34-16-28-17)27(31)30-25(19-9-13-22(33-3)14-10-19)23-6-4-5-20(24(23)29-30)15-18-7-11-21(32-2)12-8-18/h7-16,23,25H,4-6H2,1-3H3/b20-15-/t23-,25+/m1/s1 |
| InChIKey | HGLNKNXKPDBIBR-IIZKOBDISA-N |
| XLogP | 5.91 |
| TPSA | 64.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |