C33H37N5O3S — CID 40736037
[(3S,3aS,7E)-3-(4-morpholin-4-ylphenyl)-7-[(4-morpholin-4-ylphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-methyl-1,3-thiazol-5-yl)methanone (PubChem CID 40736037) has the molecular formula C33H37N5O3S and a molecular weight of 583.76 g/mol. Its IUPAC name is [(3S,3aS,7E)-3-(4-morpholin-4-ylphenyl)-7-[(4-morpholin-4-ylphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-methyl-1,3-thiazol-5-yl)methanone.
| Compound Name | [(3S,3aS,7E)-3-(4-morpholin-4-ylphenyl)-7-[(4-morpholin-4-ylphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-methyl-1,3-thiazol-5-yl)methanone |
|---|---|
| PubChem CID | 40736037 |
| Molecular Formula | C33H37N5O3S |
| Molecular Weight | 583.76 g/mol |
| Exact Mass | 583.26 |
| IUPAC Name | [(3S,3aS,7E)-3-(4-morpholin-4-ylphenyl)-7-[(4-morpholin-4-ylphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-methyl-1,3-thiazol-5-yl)methanone |
| SMILES | Cc1ncsc1C(=O)N1N=C2/C(=C/c3ccc(N4CCOCC4)cc3)CCC[C@H]2[C@H]1c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C33H37N5O3S/c1-23-32(42-22-34-23)33(39)38-31(25-7-11-28(12-8-25)37-15-19-41-20-16-37)29-4-2-3-26(30(29)35-38)21-24-5-9-27(10-6-24)36-13-17-40-18-14-36/h5-12,21-22,29,31H,2-4,13-20H2,1H3/b26-21+/t29-,31-/m1/s1 |
| InChIKey | SEZBQIVMXUPAFS-VLBVFKKOSA-N |
| XLogP | 5.56 |
| TPSA | 70.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.76 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|