C15H20N4OS — CID 93011687
1-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-3-[(E)-(3-hydroxyphenyl)methylideneamino]thiourea (PubChem CID 93011687) has the molecular formula C15H20N4OS and a molecular weight of 304.42 g/mol. Its IUPAC name is 1-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-3-[(E)-(3-hydroxyphenyl)methylideneamino]thiourea.
| Compound Name | 1-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-3-[(E)-(3-hydroxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 93011687 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 1-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-3-[(E)-(3-hydroxyphenyl)methylideneamino]thiourea |
| SMILES | Oc1cccc(/C=N/NC(=S)N[C@@H]2CN3CCC2CC3)c1 |
| InChI | InChI=1S/C15H20N4OS/c20-13-3-1-2-11(8-13)9-16-18-15(21)17-14-10-19-6-4-12(14)5-7-19/h1-3,8-9,12,14,20H,4-7,10H2,(H2,17,18,21)/b16-9+/t14-/m1/s1 |
| InChIKey | LYFOAKWCOZKQFD-BRYYZUPOSA-N |
| XLogP | 1.28 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|