C25H27N3O3 — CID 93013324
3,4-dihydro-1H-isoquinolin-2-yl-[(6S)-6-(2,5-dimethoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl]methanone (PubChem CID 93013324) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is 3,4-dihydro-1H-isoquinolin-2-yl-[(6S)-6-(2,5-dimethoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl]methanone.
| Compound Name | 3,4-dihydro-1H-isoquinolin-2-yl-[(6S)-6-(2,5-dimethoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl]methanone |
|---|---|
| PubChem CID | 93013324 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 3,4-dihydro-1H-isoquinolin-2-yl-[(6S)-6-(2,5-dimethoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl]methanone |
| SMILES | COc1ccc(OC)c([C@@H]2CCc3nc(C(=O)N4CCc5ccccc5C4)cn3C2)c1 |
| InChI | InChI=1S/C25H27N3O3/c1-30-20-8-9-23(31-2)21(13-20)19-7-10-24-26-22(16-28(24)15-19)25(29)27-12-11-17-5-3-4-6-18(17)14-27/h3-6,8-9,13,16,19H,7,10-12,14-15H2,1-2H3/t19-/m1/s1 |
| InChIKey | AOLPKOBHEIZWAO-LJQANCHMSA-N |
| XLogP | 3.83 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |