C16H23N3O5S — CID 9301672
(2S)-2-[(4-acetylphenyl)sulfonylamino]-N-[2-oxo-2-(propan-2-ylamino)ethyl]propanamide (PubChem CID 9301672) has the molecular formula C16H23N3O5S and a molecular weight of 369.44 g/mol. Its IUPAC name is (2S)-2-[(4-acetylphenyl)sulfonylamino]-N-[2-oxo-2-(propan-2-ylamino)ethyl]propanamide.
| Compound Name | (2S)-2-[(4-acetylphenyl)sulfonylamino]-N-[2-oxo-2-(propan-2-ylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 9301672 |
| Molecular Formula | C16H23N3O5S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | (2S)-2-[(4-acetylphenyl)sulfonylamino]-N-[2-oxo-2-(propan-2-ylamino)ethyl]propanamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N[C@@H](C)C(=O)NCC(=O)NC(C)C)cc1 |
| InChI | InChI=1S/C16H23N3O5S/c1-10(2)18-15(21)9-17-16(22)11(3)19-25(23,24)14-7-5-13(6-8-14)12(4)20/h5-8,10-11,19H,9H2,1-4H3,(H,17,22)(H,18,21)/t11-/m0/s1 |
| InChIKey | KFYWJTOYHJNBAZ-NSHDSACASA-N |
| XLogP | 0.20 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |