C18H18BrN3O2 — CID 93017803
(3R)-1-[(3-bromophenyl)methyl]-5-oxo-N-(pyridin-2-ylmethyl)pyrrolidine-3-carboxamide (PubChem CID 93017803) has the molecular formula C18H18BrN3O2 and a molecular weight of 388.27 g/mol. Its IUPAC name is (3R)-1-[(3-bromophenyl)methyl]-5-oxo-N-(pyridin-2-ylmethyl)pyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-[(3-bromophenyl)methyl]-5-oxo-N-(pyridin-2-ylmethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 93017803 |
| Molecular Formula | C18H18BrN3O2 |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | (3R)-1-[(3-bromophenyl)methyl]-5-oxo-N-(pyridin-2-ylmethyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(NCc1ccccn1)[C@@H]1CC(=O)N(Cc2cccc(Br)c2)C1 |
| InChI | InChI=1S/C18H18BrN3O2/c19-15-5-3-4-13(8-15)11-22-12-14(9-17(22)23)18(24)21-10-16-6-1-2-7-20-16/h1-8,14H,9-12H2,(H,21,24)/t14-/m1/s1 |
| InChIKey | IZKUABNTCWSCPW-CQSZACIVSA-N |
| XLogP | 2.51 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |