C21H23BrN2O2 — CID 93017811
(3R)-1-[(3-bromophenyl)methyl]-5-oxo-N-(3-phenylpropyl)pyrrolidine-3-carboxamide (PubChem CID 93017811) has the molecular formula C21H23BrN2O2 and a molecular weight of 415.33 g/mol. Its IUPAC name is (3R)-1-[(3-bromophenyl)methyl]-5-oxo-N-(3-phenylpropyl)pyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-[(3-bromophenyl)methyl]-5-oxo-N-(3-phenylpropyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 93017811 |
| Molecular Formula | C21H23BrN2O2 |
| Molecular Weight | 415.33 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | (3R)-1-[(3-bromophenyl)methyl]-5-oxo-N-(3-phenylpropyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)[C@@H]1CC(=O)N(Cc2cccc(Br)c2)C1 |
| InChI | InChI=1S/C21H23BrN2O2/c22-19-10-4-8-17(12-19)14-24-15-18(13-20(24)25)21(26)23-11-5-9-16-6-2-1-3-7-16/h1-4,6-8,10,12,18H,5,9,11,13-15H2,(H,23,26)/t18-/m1/s1 |
| InChIKey | PIHPBLCYHKOWAM-GOSISDBHSA-N |
| XLogP | 3.55 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|