C23H30N2O3S — CID 9301857
5-(cyclohexylsulfamoyl)-2-methyl-N-[(2S)-2-phenylpropyl]benzamide (PubChem CID 9301857) has the molecular formula C23H30N2O3S and a molecular weight of 414.57 g/mol. Its IUPAC name is 5-(cyclohexylsulfamoyl)-2-methyl-N-[(2S)-2-phenylpropyl]benzamide.
| Compound Name | 5-(cyclohexylsulfamoyl)-2-methyl-N-[(2S)-2-phenylpropyl]benzamide |
|---|---|
| PubChem CID | 9301857 |
| Molecular Formula | C23H30N2O3S |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 5-(cyclohexylsulfamoyl)-2-methyl-N-[(2S)-2-phenylpropyl]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)NC2CCCCC2)cc1C(=O)NC[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C23H30N2O3S/c1-17-13-14-21(29(27,28)25-20-11-7-4-8-12-20)15-22(17)23(26)24-16-18(2)19-9-5-3-6-10-19/h3,5-6,9-10,13-15,18,20,25H,4,7-8,11-12,16H2,1-2H3,(H,24,26)/t18-/m1/s1 |
| InChIKey | FIEACWNVDFRXFO-GOSISDBHSA-N |
| XLogP | 4.14 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |