C17H24N2O5S — CID 119187975
2-[[5-(cyclopropylsulfamoyl)-2-methylbenzoyl]amino]-4-methylpentanoic acid (PubChem CID 119187975) has the molecular formula C17H24N2O5S and a molecular weight of 368.46 g/mol. Its IUPAC name is 2-[[5-(cyclopropylsulfamoyl)-2-methylbenzoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[5-(cyclopropylsulfamoyl)-2-methylbenzoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119187975 |
| Molecular Formula | C17H24N2O5S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 2-[[5-(cyclopropylsulfamoyl)-2-methylbenzoyl]amino]-4-methylpentanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)NC2CC2)cc1C(=O)NC(CC(C)C)C(=O)O |
| InChI | InChI=1S/C17H24N2O5S/c1-10(2)8-15(17(21)22)18-16(20)14-9-13(7-4-11(14)3)25(23,24)19-12-5-6-12/h4,7,9-10,12,15,19H,5-6,8H2,1-3H3,(H,18,20)(H,21,22) |
| InChIKey | JGODGFNXDJBMLU-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |