C17H22N2O5S — CID 119217146
2-[1-[[5-(cyclopropylsulfamoyl)-2-methylbenzoyl]amino]cyclobutyl]acetic acid (PubChem CID 119217146) has the molecular formula C17H22N2O5S and a molecular weight of 366.44 g/mol. Its IUPAC name is 2-[1-[[5-(cyclopropylsulfamoyl)-2-methylbenzoyl]amino]cyclobutyl]acetic acid.
| Compound Name | 2-[1-[[5-(cyclopropylsulfamoyl)-2-methylbenzoyl]amino]cyclobutyl]acetic acid |
|---|---|
| PubChem CID | 119217146 |
| Molecular Formula | C17H22N2O5S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 2-[1-[[5-(cyclopropylsulfamoyl)-2-methylbenzoyl]amino]cyclobutyl]acetic acid |
| SMILES | Cc1ccc(S(=O)(=O)NC2CC2)cc1C(=O)NC1(CC(=O)O)CCC1 |
| InChI | InChI=1S/C17H22N2O5S/c1-11-3-6-13(25(23,24)19-12-4-5-12)9-14(11)16(22)18-17(7-2-8-17)10-15(20)21/h3,6,9,12,19H,2,4-5,7-8,10H2,1H3,(H,18,22)(H,20,21) |
| InChIKey | MQQOOKYTTBGSGY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |