C21H27ClN2O6 — CID 93019676
(2R)-2-chloro-N-[[(2S)-oxolan-2-yl]methyl]-N-[[5-(3,4,5-trimethoxyphenyl)-1,2-oxazol-3-yl]methyl]propanamide (PubChem CID 93019676) has the molecular formula C21H27ClN2O6 and a molecular weight of 438.91 g/mol. Its IUPAC name is (2R)-2-chloro-N-[[(2S)-oxolan-2-yl]methyl]-N-[[5-(3,4,5-trimethoxyphenyl)-1,2-oxazol-3-yl]methyl]propanamide.
| Compound Name | (2R)-2-chloro-N-[[(2S)-oxolan-2-yl]methyl]-N-[[5-(3,4,5-trimethoxyphenyl)-1,2-oxazol-3-yl]methyl]propanamide |
|---|---|
| PubChem CID | 93019676 |
| Molecular Formula | C21H27ClN2O6 |
| Molecular Weight | 438.91 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | (2R)-2-chloro-N-[[(2S)-oxolan-2-yl]methyl]-N-[[5-(3,4,5-trimethoxyphenyl)-1,2-oxazol-3-yl]methyl]propanamide |
| SMILES | COc1cc(-c2cc(CN(C[C@@H]3CCCO3)C(=O)[C@@H](C)Cl)no2)cc(OC)c1OC |
| InChI | InChI=1S/C21H27ClN2O6/c1-13(22)21(25)24(12-16-6-5-7-29-16)11-15-10-17(30-23-15)14-8-18(26-2)20(28-4)19(9-14)27-3/h8-10,13,16H,5-7,11-12H2,1-4H3/t13-,16+/m1/s1 |
| InChIKey | OSBVATJIWNCEIP-CJNGLKHVSA-N |
| XLogP | 3.50 |
| TPSA | 83.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.91 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|