C24H27N3O9S — CID 98425371
4-nitro-N-[[(2R)-oxolan-2-yl]methyl]-N-[[5-(3,4,5-trimethoxyphenyl)-1,2-oxazol-3-yl]methyl]benzenesulfonamide (PubChem CID 98425371) has the molecular formula C24H27N3O9S and a molecular weight of 533.56 g/mol. Its IUPAC name is 4-nitro-N-[[(2R)-oxolan-2-yl]methyl]-N-[[5-(3,4,5-trimethoxyphenyl)-1,2-oxazol-3-yl]methyl]benzenesulfonamide.
| Compound Name | 4-nitro-N-[[(2R)-oxolan-2-yl]methyl]-N-[[5-(3,4,5-trimethoxyphenyl)-1,2-oxazol-3-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 98425371 |
| Molecular Formula | C24H27N3O9S |
| Molecular Weight | 533.56 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | 4-nitro-N-[[(2R)-oxolan-2-yl]methyl]-N-[[5-(3,4,5-trimethoxyphenyl)-1,2-oxazol-3-yl]methyl]benzenesulfonamide |
| SMILES | COc1cc(-c2cc(CN(C[C@H]3CCCO3)S(=O)(=O)c3ccc([N+](=O)[O-])cc3)no2)cc(OC)c1OC |
| InChI | InChI=1S/C24H27N3O9S/c1-32-22-11-16(12-23(33-2)24(22)34-3)21-13-17(25-36-21)14-26(15-19-5-4-10-35-19)37(30,31)20-8-6-18(7-9-20)27(28)29/h6-9,11-13,19H,4-5,10,14-15H2,1-3H3/t19-/m1/s1 |
| InChIKey | SYGPJTURJDWBFP-LJQANCHMSA-N |
| XLogP | 3.65 |
| TPSA | 143.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.56 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|