C21H27N3O7S — CID 93032636
2-[(2-methoxy-5-methylphenyl)sulfonyl-methylamino]-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]acetamide (PubChem CID 93032636) has the molecular formula C21H27N3O7S and a molecular weight of 465.53 g/mol. Its IUPAC name is 2-[(2-methoxy-5-methylphenyl)sulfonyl-methylamino]-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[(2-methoxy-5-methylphenyl)sulfonyl-methylamino]-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 93032636 |
| Molecular Formula | C21H27N3O7S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 2-[(2-methoxy-5-methylphenyl)sulfonyl-methylamino]-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(C)cc1S(=O)(=O)N(C)CC(=O)N/N=C/c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C21H27N3O7S/c1-14-7-8-16(28-3)19(9-14)32(26,27)24(2)13-20(25)23-22-12-15-10-17(29-4)21(31-6)18(11-15)30-5/h7-12H,13H2,1-6H3,(H,23,25)/b22-12+ |
| InChIKey | VEEYKQWUVTXSRJ-WSDLNYQXSA-N |
| XLogP | 1.80 |
| TPSA | 115.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|