C17H15N3O2S — CID 930415
1-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-phenylurea (PubChem CID 930415) has the molecular formula C17H15N3O2S and a molecular weight of 325.39 g/mol. Its IUPAC name is 1-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-phenylurea.
| Compound Name | 1-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-phenylurea |
|---|---|
| PubChem CID | 930415 |
| Molecular Formula | C17H15N3O2S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 1-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-phenylurea |
| SMILES | COc1ccc(-c2csc(NC(=O)Nc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C17H15N3O2S/c1-22-14-9-7-12(8-10-14)15-11-23-17(19-15)20-16(21)18-13-5-3-2-4-6-13/h2-11H,1H3,(H2,18,19,20,21) |
| InChIKey | IGGKWFIPADVNEA-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |