C17H18FN3O3S — CID 93062729
(3R)-6-fluoro-1,1-dioxo-N-(2,4,6-trimethylphenyl)-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-3-carboxamide (PubChem CID 93062729) has the molecular formula C17H18FN3O3S and a molecular weight of 363.41 g/mol. Its IUPAC name is (3R)-6-fluoro-1,1-dioxo-N-(2,4,6-trimethylphenyl)-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-3-carboxamide.
| Compound Name | (3R)-6-fluoro-1,1-dioxo-N-(2,4,6-trimethylphenyl)-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-3-carboxamide |
|---|---|
| PubChem CID | 93062729 |
| Molecular Formula | C17H18FN3O3S |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | (3R)-6-fluoro-1,1-dioxo-N-(2,4,6-trimethylphenyl)-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-3-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)[C@@H]2Nc3cc(F)ccc3S(=O)(=O)N2)c(C)c1 |
| InChI | InChI=1S/C17H18FN3O3S/c1-9-6-10(2)15(11(3)7-9)20-17(22)16-19-13-8-12(18)4-5-14(13)25(23,24)21-16/h4-8,16,19,21H,1-3H3,(H,20,22)/t16-/m1/s1 |
| InChIKey | ICNJUKGCDOSWSU-MRXNPFEDSA-N |
| XLogP | 2.42 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |