C21H18ClF3N4O — CID 93065192
(3S)-N-(2-chlorophenyl)-1-[3-(trifluoromethyl)quinoxalin-2-yl]piperidine-3-carboxamide (PubChem CID 93065192) has the molecular formula C21H18ClF3N4O and a molecular weight of 434.85 g/mol. Its IUPAC name is (3S)-N-(2-chlorophenyl)-1-[3-(trifluoromethyl)quinoxalin-2-yl]piperidine-3-carboxamide.
| Compound Name | (3S)-N-(2-chlorophenyl)-1-[3-(trifluoromethyl)quinoxalin-2-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 93065192 |
| Molecular Formula | C21H18ClF3N4O |
| Molecular Weight | 434.85 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | (3S)-N-(2-chlorophenyl)-1-[3-(trifluoromethyl)quinoxalin-2-yl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1Cl)[C@H]1CCCN(c2nc3ccccc3nc2C(F)(F)F)C1 |
| InChI | InChI=1S/C21H18ClF3N4O/c22-14-7-1-2-8-15(14)28-20(30)13-6-5-11-29(12-13)19-18(21(23,24)25)26-16-9-3-4-10-17(16)27-19/h1-4,7-10,13H,5-6,11-12H2,(H,28,30)/t13-/m0/s1 |
| InChIKey | HPOSSUKFTCDABR-ZDUSSCGKSA-N |
| XLogP | 5.16 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.85 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |