C23H23F3N4O — CID 95063717
(3R)-N-(4-ethylphenyl)-1-[3-(trifluoromethyl)quinoxalin-2-yl]piperidine-3-carboxamide (PubChem CID 95063717) has the molecular formula C23H23F3N4O and a molecular weight of 428.46 g/mol. Its IUPAC name is (3R)-N-(4-ethylphenyl)-1-[3-(trifluoromethyl)quinoxalin-2-yl]piperidine-3-carboxamide.
| Compound Name | (3R)-N-(4-ethylphenyl)-1-[3-(trifluoromethyl)quinoxalin-2-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95063717 |
| Molecular Formula | C23H23F3N4O |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | (3R)-N-(4-ethylphenyl)-1-[3-(trifluoromethyl)quinoxalin-2-yl]piperidine-3-carboxamide |
| SMILES | CCc1ccc(NC(=O)[C@@H]2CCCN(c3nc4ccccc4nc3C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C23H23F3N4O/c1-2-15-9-11-17(12-10-15)27-22(31)16-6-5-13-30(14-16)21-20(23(24,25)26)28-18-7-3-4-8-19(18)29-21/h3-4,7-12,16H,2,5-6,13-14H2,1H3,(H,27,31)/t16-/m1/s1 |
| InChIKey | PIZVRBUBISLVEY-MRXNPFEDSA-N |
| XLogP | 5.07 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |