C23H21N3O3 — CID 93068546
5-(3,7-dimethyl-1-benzofuran-2-yl)-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-1,3,4-oxadiazole-2-carboxamide (PubChem CID 93068546) has the molecular formula C23H21N3O3 and a molecular weight of 387.44 g/mol. Its IUPAC name is 5-(3,7-dimethyl-1-benzofuran-2-yl)-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | 5-(3,7-dimethyl-1-benzofuran-2-yl)-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 93068546 |
| Molecular Formula | C23H21N3O3 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 5-(3,7-dimethyl-1-benzofuran-2-yl)-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-1,3,4-oxadiazole-2-carboxamide |
| SMILES | Cc1c(-c2nnc(C(=O)N[C@@H]3CCCc4ccccc43)o2)oc2c(C)cccc12 |
| InChI | InChI=1S/C23H21N3O3/c1-13-7-5-11-16-14(2)20(28-19(13)16)22-25-26-23(29-22)21(27)24-18-12-6-9-15-8-3-4-10-17(15)18/h3-5,7-8,10-11,18H,6,9,12H2,1-2H3,(H,24,27)/t18-/m1/s1 |
| InChIKey | ZGQTZSJFTHMIME-GOSISDBHSA-N |
| XLogP | 4.91 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |