C16H16ClN3O3 — CID 9307115
2-[[(1R)-1-(2-chlorophenyl)ethyl]amino]-N-(4-nitrophenyl)acetamide (PubChem CID 9307115) has the molecular formula C16H16ClN3O3 and a molecular weight of 333.78 g/mol. Its IUPAC name is 2-[[(1R)-1-(2-chlorophenyl)ethyl]amino]-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[[(1R)-1-(2-chlorophenyl)ethyl]amino]-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 9307115 |
| Molecular Formula | C16H16ClN3O3 |
| Molecular Weight | 333.78 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 2-[[(1R)-1-(2-chlorophenyl)ethyl]amino]-N-(4-nitrophenyl)acetamide |
| SMILES | C[C@@H](NCC(=O)Nc1ccc([N+](=O)[O-])cc1)c1ccccc1Cl |
| InChI | InChI=1S/C16H16ClN3O3/c1-11(14-4-2-3-5-15(14)17)18-10-16(21)19-12-6-8-13(9-7-12)20(22)23/h2-9,11,18H,10H2,1H3,(H,19,21)/t11-/m1/s1 |
| InChIKey | NXDZATVRPYXQKB-LLVKDONJSA-N |
| XLogP | 3.54 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.78 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|