C8H13N3O — CID 93081574
(2S)-2-[(3-amino-2-pyridinyl)amino]propan-1-ol (PubChem CID 93081574) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is (2S)-2-[(3-amino-2-pyridinyl)amino]propan-1-ol.
| Compound Name | (2S)-2-[(3-amino-2-pyridinyl)amino]propan-1-ol |
|---|---|
| PubChem CID | 93081574 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | (2S)-2-[(3-amino-2-pyridinyl)amino]propan-1-ol |
| SMILES | C[C@@H](CO)Nc1ncccc1N |
| InChI | InChI=1S/C8H13N3O/c1-6(5-12)11-8-7(9)3-2-4-10-8/h2-4,6,12H,5,9H2,1H3,(H,10,11)/t6-/m0/s1 |
| InChIKey | BUVWONBNNNDHME-LURJTMIESA-N |
| XLogP | 0.46 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |