C14H14F3N5O3 — CID 9308901
N-[2-(4-nitroanilino)ethyl]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide (PubChem CID 9308901) has the molecular formula C14H14F3N5O3 and a molecular weight of 357.29 g/mol. Its IUPAC name is N-[2-(4-nitroanilino)ethyl]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide.
| Compound Name | N-[2-(4-nitroanilino)ethyl]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 9308901 |
| Molecular Formula | C14H14F3N5O3 |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | N-[2-(4-nitroanilino)ethyl]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide |
| SMILES | O=C(Cn1ccc(C(F)(F)F)n1)NCCNc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H14F3N5O3/c15-14(16,17)12-5-8-21(20-12)9-13(23)19-7-6-18-10-1-3-11(4-2-10)22(24)25/h1-5,8,18H,6-7,9H2,(H,19,23) |
| InChIKey | YPGWTHKGPDFMRU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|