C22H28N2O5 — CID 9309369
(2S)-2-[2-(4-methoxyphenyl)-4-nitrophenoxy]-N,N-di(propan-2-yl)propanamide (PubChem CID 9309369) has the molecular formula C22H28N2O5 and a molecular weight of 400.48 g/mol. Its IUPAC name is (2S)-2-[2-(4-methoxyphenyl)-4-nitrophenoxy]-N,N-di(propan-2-yl)propanamide.
| Compound Name | (2S)-2-[2-(4-methoxyphenyl)-4-nitrophenoxy]-N,N-di(propan-2-yl)propanamide |
|---|---|
| PubChem CID | 9309369 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | (2S)-2-[2-(4-methoxyphenyl)-4-nitrophenoxy]-N,N-di(propan-2-yl)propanamide |
| SMILES | COc1ccc(-c2cc([N+](=O)[O-])ccc2O[C@@H](C)C(=O)N(C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C22H28N2O5/c1-14(2)23(15(3)4)22(25)16(5)29-21-12-9-18(24(26)27)13-20(21)17-7-10-19(28-6)11-8-17/h7-16H,1-6H3/t16-/m0/s1 |
| InChIKey | UIDWKKJXJKDKDC-INIZCTEOSA-N |
| XLogP | 4.68 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|