C18H19ClN2O6 — CID 9310280
[(2R)-1-(tert-butylcarbamoylamino)-1-oxopropan-2-yl] 6-chloro-4-oxochromene-2-carboxylate (PubChem CID 9310280) has the molecular formula C18H19ClN2O6 and a molecular weight of 394.81 g/mol. Its IUPAC name is [(2R)-1-(tert-butylcarbamoylamino)-1-oxopropan-2-yl] 6-chloro-4-oxochromene-2-carboxylate.
| Compound Name | [(2R)-1-(tert-butylcarbamoylamino)-1-oxopropan-2-yl] 6-chloro-4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 9310280 |
| Molecular Formula | C18H19ClN2O6 |
| Molecular Weight | 394.81 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | [(2R)-1-(tert-butylcarbamoylamino)-1-oxopropan-2-yl] 6-chloro-4-oxochromene-2-carboxylate |
| SMILES | C[C@@H](OC(=O)c1cc(=O)c2cc(Cl)ccc2o1)C(=O)NC(=O)NC(C)(C)C |
| InChI | InChI=1S/C18H19ClN2O6/c1-9(15(23)20-17(25)21-18(2,3)4)26-16(24)14-8-12(22)11-7-10(19)5-6-13(11)27-14/h5-9H,1-4H3,(H2,20,21,23,25)/t9-/m1/s1 |
| InChIKey | FUBRMHCMASDTRD-SECBINFHSA-N |
| XLogP | 2.62 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.81 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |