C14H10ClN5OS — CID 931186
1-(4-chlorophenyl)-3-(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)urea (PubChem CID 931186) has the molecular formula C14H10ClN5OS and a molecular weight of 331.79 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-(4-chlorophenyl)-3-(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 931186 |
| Molecular Formula | C14H10ClN5OS |
| Molecular Weight | 331.79 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)Nc1nnc(-c2ccncc2)s1 |
| InChI | InChI=1S/C14H10ClN5OS/c15-10-1-3-11(4-2-10)17-13(21)18-14-20-19-12(22-14)9-5-7-16-8-6-9/h1-8H,(H2,17,18,20,21) |
| InChIKey | OIQSVOVTWPXCTN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.79 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |