C24H21ClN2O2S — CID 93123942
(2S)-2-chloro-N-[2-[(2R)-3-(2-methylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]-2-phenylacetamide (PubChem CID 93123942) has the molecular formula C24H21ClN2O2S and a molecular weight of 436.96 g/mol. Its IUPAC name is (2S)-2-chloro-N-[2-[(2R)-3-(2-methylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]-2-phenylacetamide.
| Compound Name | (2S)-2-chloro-N-[2-[(2R)-3-(2-methylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 93123942 |
| Molecular Formula | C24H21ClN2O2S |
| Molecular Weight | 436.96 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | (2S)-2-chloro-N-[2-[(2R)-3-(2-methylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]-2-phenylacetamide |
| SMILES | Cc1ccccc1N1C(=O)CS[C@@H]1c1ccccc1NC(=O)[C@@H](Cl)c1ccccc1 |
| InChI | InChI=1S/C24H21ClN2O2S/c1-16-9-5-8-14-20(16)27-21(28)15-30-24(27)18-12-6-7-13-19(18)26-23(29)22(25)17-10-3-2-4-11-17/h2-14,22,24H,15H2,1H3,(H,26,29)/t22-,24+/m0/s1 |
| InChIKey | CLLNHILNHRFDNK-LADGPHEKSA-N |
| XLogP | 5.69 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.96 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|