C24H20ClFN2O2S — CID 93127406
(2R)-2-chloro-N-[3-[(2R)-3-(3-fluoro-2-methylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]-2-phenylacetamide (PubChem CID 93127406) has the molecular formula C24H20ClFN2O2S and a molecular weight of 454.95 g/mol. Its IUPAC name is (2R)-2-chloro-N-[3-[(2R)-3-(3-fluoro-2-methylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]-2-phenylacetamide.
| Compound Name | (2R)-2-chloro-N-[3-[(2R)-3-(3-fluoro-2-methylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 93127406 |
| Molecular Formula | C24H20ClFN2O2S |
| Molecular Weight | 454.95 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | (2R)-2-chloro-N-[3-[(2R)-3-(3-fluoro-2-methylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]-2-phenylacetamide |
| SMILES | Cc1c(F)cccc1N1C(=O)CS[C@@H]1c1cccc(NC(=O)[C@H](Cl)c2ccccc2)c1 |
| InChI | InChI=1S/C24H20ClFN2O2S/c1-15-19(26)11-6-12-20(15)28-21(29)14-31-24(28)17-9-5-10-18(13-17)27-23(30)22(25)16-7-3-2-4-8-16/h2-13,22,24H,14H2,1H3,(H,27,30)/t22-,24-/m1/s1 |
| InChIKey | GYCLLHIFKIZDCW-ISKFKSNPSA-N |
| XLogP | 5.83 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.95 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|