C25H23N3O4S — CID 93125958
N-[4-[(2S)-3-(4-ethylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]-4-methyl-3-nitrobenzamide (PubChem CID 93125958) has the molecular formula C25H23N3O4S and a molecular weight of 461.54 g/mol. Its IUPAC name is N-[4-[(2S)-3-(4-ethylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]-4-methyl-3-nitrobenzamide.
| Compound Name | N-[4-[(2S)-3-(4-ethylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 93125958 |
| Molecular Formula | C25H23N3O4S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | N-[4-[(2S)-3-(4-ethylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]-4-methyl-3-nitrobenzamide |
| SMILES | CCc1ccc(N2C(=O)CS[C@H]2c2ccc(NC(=O)c3ccc(C)c([N+](=O)[O-])c3)cc2)cc1 |
| InChI | InChI=1S/C25H23N3O4S/c1-3-17-5-12-21(13-6-17)27-23(29)15-33-25(27)18-8-10-20(11-9-18)26-24(30)19-7-4-16(2)22(14-19)28(31)32/h4-14,25H,3,15H2,1-2H3,(H,26,30)/t25-/m0/s1 |
| InChIKey | ZCBGJHOAYQDQBI-VWLOTQADSA-N |
| XLogP | 5.50 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|