C21H25ClN6O — CID 93126529
(2R)-2-chloro-1-[4-(1-phenyl-6-propylpyrazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]propan-1-one (PubChem CID 93126529) has the molecular formula C21H25ClN6O and a molecular weight of 412.93 g/mol. Its IUPAC name is (2R)-2-chloro-1-[4-(1-phenyl-6-propylpyrazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]propan-1-one.
| Compound Name | (2R)-2-chloro-1-[4-(1-phenyl-6-propylpyrazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 93126529 |
| Molecular Formula | C21H25ClN6O |
| Molecular Weight | 412.93 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | (2R)-2-chloro-1-[4-(1-phenyl-6-propylpyrazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]propan-1-one |
| SMILES | CCCc1nc(N2CCN(C(=O)[C@@H](C)Cl)CC2)c2cnn(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C21H25ClN6O/c1-3-7-18-24-19(26-10-12-27(13-11-26)21(29)15(2)22)17-14-23-28(20(17)25-18)16-8-5-4-6-9-16/h4-6,8-9,14-15H,3,7,10-13H2,1-2H3/t15-/m1/s1 |
| InChIKey | QQJNMSLGICOQGM-OAHLLOKOSA-N |
| XLogP | 3.04 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.93 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|