C22H27ClN6O — CID 93126543
(2R)-2-chloro-1-[4-(1-phenyl-6-propylpyrazolo[5,4-d]pyrimidin-4-yl)-1,4-diazepan-1-yl]propan-1-one (PubChem CID 93126543) has the molecular formula C22H27ClN6O and a molecular weight of 426.95 g/mol. Its IUPAC name is (2R)-2-chloro-1-[4-(1-phenyl-6-propylpyrazolo[5,4-d]pyrimidin-4-yl)-1,4-diazepan-1-yl]propan-1-one.
| Compound Name | (2R)-2-chloro-1-[4-(1-phenyl-6-propylpyrazolo[5,4-d]pyrimidin-4-yl)-1,4-diazepan-1-yl]propan-1-one |
|---|---|
| PubChem CID | 93126543 |
| Molecular Formula | C22H27ClN6O |
| Molecular Weight | 426.95 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | (2R)-2-chloro-1-[4-(1-phenyl-6-propylpyrazolo[5,4-d]pyrimidin-4-yl)-1,4-diazepan-1-yl]propan-1-one |
| SMILES | CCCc1nc(N2CCCN(C(=O)[C@@H](C)Cl)CC2)c2cnn(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C22H27ClN6O/c1-3-8-19-25-20(27-11-7-12-28(14-13-27)22(30)16(2)23)18-15-24-29(21(18)26-19)17-9-5-4-6-10-17/h4-6,9-10,15-16H,3,7-8,11-14H2,1-2H3/t16-/m1/s1 |
| InChIKey | GVYQXFUMKGZBHO-MRXNPFEDSA-N |
| XLogP | 3.43 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.95 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|