C20H27N7O — CID 93140972
1-[2-[[6-[(2R)-butan-2-yl]-1-phenylpyrazolo[3,4-d]pyrimidin-4-yl]amino]ethyl]-3-ethylurea (PubChem CID 93140972) has the molecular formula C20H27N7O and a molecular weight of 381.48 g/mol. Its IUPAC name is 1-[2-[[6-[(2R)-butan-2-yl]-1-phenylpyrazolo[3,4-d]pyrimidin-4-yl]amino]ethyl]-3-ethylurea.
| Compound Name | 1-[2-[[6-[(2R)-butan-2-yl]-1-phenylpyrazolo[3,4-d]pyrimidin-4-yl]amino]ethyl]-3-ethylurea |
|---|---|
| PubChem CID | 93140972 |
| Molecular Formula | C20H27N7O |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | 1-[2-[[6-[(2R)-butan-2-yl]-1-phenylpyrazolo[3,4-d]pyrimidin-4-yl]amino]ethyl]-3-ethylurea |
| SMILES | CCNC(=O)NCCNc1nc([C@H](C)CC)nc2c1cnn2-c1ccccc1 |
| InChI | InChI=1S/C20H27N7O/c1-4-14(3)17-25-18(22-11-12-23-20(28)21-5-2)16-13-24-27(19(16)26-17)15-9-7-6-8-10-15/h6-10,13-14H,4-5,11-12H2,1-3H3,(H2,21,23,28)(H,22,25,26)/t14-/m1/s1 |
| InChIKey | CFPXPVKHKZSAHW-CQSZACIVSA-N |
| XLogP | 3.06 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|