C24H25ClN6O — CID 93140882
N-[2-[[6-[(2R)-butan-2-yl]-1-phenylpyrazolo[3,4-d]pyrimidin-4-yl]amino]ethyl]-4-chlorobenzamide (PubChem CID 93140882) has the molecular formula C24H25ClN6O and a molecular weight of 448.96 g/mol. Its IUPAC name is N-[2-[[6-[(2R)-butan-2-yl]-1-phenylpyrazolo[3,4-d]pyrimidin-4-yl]amino]ethyl]-4-chlorobenzamide.
| Compound Name | N-[2-[[6-[(2R)-butan-2-yl]-1-phenylpyrazolo[3,4-d]pyrimidin-4-yl]amino]ethyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 93140882 |
| Molecular Formula | C24H25ClN6O |
| Molecular Weight | 448.96 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | N-[2-[[6-[(2R)-butan-2-yl]-1-phenylpyrazolo[3,4-d]pyrimidin-4-yl]amino]ethyl]-4-chlorobenzamide |
| SMILES | CC[C@@H](C)c1nc(NCCNC(=O)c2ccc(Cl)cc2)c2cnn(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C24H25ClN6O/c1-3-16(2)21-29-22(26-13-14-27-24(32)17-9-11-18(25)12-10-17)20-15-28-31(23(20)30-21)19-7-5-4-6-8-19/h4-12,15-16H,3,13-14H2,1-2H3,(H,27,32)(H,26,29,30)/t16-/m1/s1 |
| InChIKey | ZHTPGLYEVIIQED-MRXNPFEDSA-N |
| XLogP | 4.82 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.96 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|