C23H20Cl2N6O — CID 42674096
4-chloro-N-[2-[[1-(3-chlorophenyl)-6-cyclopropylpyrazolo[3,4-d]pyrimidin-4-yl]amino]ethyl]benzamide (PubChem CID 42674096) has the molecular formula C23H20Cl2N6O and a molecular weight of 467.36 g/mol. Its IUPAC name is 4-chloro-N-[2-[[1-(3-chlorophenyl)-6-cyclopropylpyrazolo[3,4-d]pyrimidin-4-yl]amino]ethyl]benzamide.
| Compound Name | 4-chloro-N-[2-[[1-(3-chlorophenyl)-6-cyclopropylpyrazolo[3,4-d]pyrimidin-4-yl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 42674096 |
| Molecular Formula | C23H20Cl2N6O |
| Molecular Weight | 467.36 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | 4-chloro-N-[2-[[1-(3-chlorophenyl)-6-cyclopropylpyrazolo[3,4-d]pyrimidin-4-yl]amino]ethyl]benzamide |
| SMILES | O=C(NCCNc1nc(C2CC2)nc2c1cnn2-c1cccc(Cl)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H20Cl2N6O/c24-16-8-6-15(7-9-16)23(32)27-11-10-26-21-19-13-28-31(18-3-1-2-17(25)12-18)22(19)30-20(29-21)14-4-5-14/h1-3,6-9,12-14H,4-5,10-11H2,(H,27,32)(H,26,29,30) |
| InChIKey | BTSXNXLHIACEBP-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.36 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|