C25H25FN6O — CID 42679920
N-[2-[[6-cyclopropyl-3-methyl-1-(4-methylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]ethyl]-4-fluorobenzamide (PubChem CID 42679920) has the molecular formula C25H25FN6O and a molecular weight of 444.51 g/mol. Its IUPAC name is N-[2-[[6-cyclopropyl-3-methyl-1-(4-methylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]ethyl]-4-fluorobenzamide.
| Compound Name | N-[2-[[6-cyclopropyl-3-methyl-1-(4-methylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]ethyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 42679920 |
| Molecular Formula | C25H25FN6O |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | N-[2-[[6-cyclopropyl-3-methyl-1-(4-methylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]ethyl]-4-fluorobenzamide |
| SMILES | Cc1ccc(-n2nc(C)c3c(NCCNC(=O)c4ccc(F)cc4)nc(C4CC4)nc32)cc1 |
| InChI | InChI=1S/C25H25FN6O/c1-15-3-11-20(12-4-15)32-24-21(16(2)31-32)23(29-22(30-24)17-5-6-17)27-13-14-28-25(33)18-7-9-19(26)10-8-18/h3-4,7-12,17H,5-6,13-14H2,1-2H3,(H,28,33)(H,27,29,30) |
| InChIKey | QOUZVERPLXFNDP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|