C22H29N7O — CID 42677283
1-tert-butyl-3-[2-[(6-cyclopropyl-3-methyl-1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]urea (PubChem CID 42677283) has the molecular formula C22H29N7O and a molecular weight of 407.52 g/mol. Its IUPAC name is 1-tert-butyl-3-[2-[(6-cyclopropyl-3-methyl-1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]urea.
| Compound Name | 1-tert-butyl-3-[2-[(6-cyclopropyl-3-methyl-1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]urea |
|---|---|
| PubChem CID | 42677283 |
| Molecular Formula | C22H29N7O |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | 1-tert-butyl-3-[2-[(6-cyclopropyl-3-methyl-1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]urea |
| SMILES | Cc1nn(-c2ccccc2)c2nc(C3CC3)nc(NCCNC(=O)NC(C)(C)C)c12 |
| InChI | InChI=1S/C22H29N7O/c1-14-17-19(23-12-13-24-21(30)27-22(2,3)4)25-18(15-10-11-15)26-20(17)29(28-14)16-8-6-5-7-9-16/h5-9,15H,10-13H2,1-4H3,(H,23,25,26)(H2,24,27,30) |
| InChIKey | ISJYOFHUWQQGDN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|