C28H31ClN6O2 — CID 42679153
N-[2-[[1-(3-chlorophenyl)-6-cyclohexyl-3-methylpyrazolo[3,4-d]pyrimidin-4-yl]amino]ethyl]-3-methoxybenzamide (PubChem CID 42679153) has the molecular formula C28H31ClN6O2 and a molecular weight of 519.05 g/mol. Its IUPAC name is N-[2-[[1-(3-chlorophenyl)-6-cyclohexyl-3-methylpyrazolo[3,4-d]pyrimidin-4-yl]amino]ethyl]-3-methoxybenzamide.
| Compound Name | N-[2-[[1-(3-chlorophenyl)-6-cyclohexyl-3-methylpyrazolo[3,4-d]pyrimidin-4-yl]amino]ethyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 42679153 |
| Molecular Formula | C28H31ClN6O2 |
| Molecular Weight | 519.05 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | N-[2-[[1-(3-chlorophenyl)-6-cyclohexyl-3-methylpyrazolo[3,4-d]pyrimidin-4-yl]amino]ethyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)NCCNc2nc(C3CCCCC3)nc3c2c(C)nn3-c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C28H31ClN6O2/c1-18-24-26(30-14-15-31-28(36)20-10-6-13-23(16-20)37-2)32-25(19-8-4-3-5-9-19)33-27(24)35(34-18)22-12-7-11-21(29)17-22/h6-7,10-13,16-17,19H,3-5,8-9,14-15H2,1-2H3,(H,31,36)(H,30,32,33) |
| InChIKey | RABZRWYKEVIKAO-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.05 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|