C23H23ClN6O2 — CID 42675604
N-[2-[[1-(3-chlorophenyl)-3,6-dimethylpyrazolo[3,4-d]pyrimidin-4-yl]amino]ethyl]-3-methoxybenzamide (PubChem CID 42675604) has the molecular formula C23H23ClN6O2 and a molecular weight of 450.93 g/mol. Its IUPAC name is N-[2-[[1-(3-chlorophenyl)-3,6-dimethylpyrazolo[3,4-d]pyrimidin-4-yl]amino]ethyl]-3-methoxybenzamide.
| Compound Name | N-[2-[[1-(3-chlorophenyl)-3,6-dimethylpyrazolo[3,4-d]pyrimidin-4-yl]amino]ethyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 42675604 |
| Molecular Formula | C23H23ClN6O2 |
| Molecular Weight | 450.93 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | N-[2-[[1-(3-chlorophenyl)-3,6-dimethylpyrazolo[3,4-d]pyrimidin-4-yl]amino]ethyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)NCCNc2nc(C)nc3c2c(C)nn3-c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C23H23ClN6O2/c1-14-20-21(25-10-11-26-23(31)16-6-4-9-19(12-16)32-3)27-15(2)28-22(20)30(29-14)18-8-5-7-17(24)13-18/h4-9,12-13H,10-11H2,1-3H3,(H,26,31)(H,25,27,28) |
| InChIKey | JUBYUESWGDJAEX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.93 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|