C26H29ClN4O4S — CID 93147391
1-[(2-benzylsulfonyl-3-prop-2-enylimidazol-4-yl)methyl]-3-(3-chlorophenyl)-1-[[(2S)-oxolan-2-yl]methyl]urea (PubChem CID 93147391) has the molecular formula C26H29ClN4O4S and a molecular weight of 529.06 g/mol. Its IUPAC name is 1-[(2-benzylsulfonyl-3-prop-2-enylimidazol-4-yl)methyl]-3-(3-chlorophenyl)-1-[[(2S)-oxolan-2-yl]methyl]urea.
| Compound Name | 1-[(2-benzylsulfonyl-3-prop-2-enylimidazol-4-yl)methyl]-3-(3-chlorophenyl)-1-[[(2S)-oxolan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 93147391 |
| Molecular Formula | C26H29ClN4O4S |
| Molecular Weight | 529.06 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | 1-[(2-benzylsulfonyl-3-prop-2-enylimidazol-4-yl)methyl]-3-(3-chlorophenyl)-1-[[(2S)-oxolan-2-yl]methyl]urea |
| SMILES | C=CCn1c(CN(C[C@@H]2CCCO2)C(=O)Nc2cccc(Cl)c2)cnc1S(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C26H29ClN4O4S/c1-2-13-31-23(16-28-26(31)36(33,34)19-20-8-4-3-5-9-20)17-30(18-24-12-7-14-35-24)25(32)29-22-11-6-10-21(27)15-22/h2-6,8-11,15-16,24H,1,7,12-14,17-19H2,(H,29,32)/t24-/m0/s1 |
| InChIKey | IAKRPRHHZQGJFJ-DEOSSOPVSA-N |
| XLogP | 4.91 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.06 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|