C30H31FN4O3S2 — CID 98436154
1-[(3-benzyl-2-benzylsulfonylimidazol-4-yl)methyl]-3-(4-fluorophenyl)-1-[[(2S)-oxolan-2-yl]methyl]thiourea (PubChem CID 98436154) has the molecular formula C30H31FN4O3S2 and a molecular weight of 578.74 g/mol. Its IUPAC name is 1-[(3-benzyl-2-benzylsulfonylimidazol-4-yl)methyl]-3-(4-fluorophenyl)-1-[[(2S)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[(3-benzyl-2-benzylsulfonylimidazol-4-yl)methyl]-3-(4-fluorophenyl)-1-[[(2S)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 98436154 |
| Molecular Formula | C30H31FN4O3S2 |
| Molecular Weight | 578.74 g/mol |
| Exact Mass | 578.18 |
| IUPAC Name | 1-[(3-benzyl-2-benzylsulfonylimidazol-4-yl)methyl]-3-(4-fluorophenyl)-1-[[(2S)-oxolan-2-yl]methyl]thiourea |
| SMILES | O=S(=O)(Cc1ccccc1)c1ncc(CN(C[C@@H]2CCCO2)C(=S)Nc2ccc(F)cc2)n1Cc1ccccc1 |
| InChI | InChI=1S/C30H31FN4O3S2/c31-25-13-15-26(16-14-25)33-29(39)34(21-28-12-7-17-38-28)20-27-18-32-30(35(27)19-23-8-3-1-4-9-23)40(36,37)22-24-10-5-2-6-11-24/h1-6,8-11,13-16,18,28H,7,12,17,19-22H2,(H,33,39)/t28-/m0/s1 |
| InChIKey | OXJSTQFEDSZFLV-NDEPHWFRSA-N |
| XLogP | 5.42 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.74 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|