C18H27NO4 — CID 93160945
(2R)-1-[(3,4-dimethoxyphenyl)methyl-propan-2-ylamino]-3-prop-2-ynoxypropan-2-ol (PubChem CID 93160945) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is (2R)-1-[(3,4-dimethoxyphenyl)methyl-propan-2-ylamino]-3-prop-2-ynoxypropan-2-ol.
| Compound Name | (2R)-1-[(3,4-dimethoxyphenyl)methyl-propan-2-ylamino]-3-prop-2-ynoxypropan-2-ol |
|---|---|
| PubChem CID | 93160945 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | (2R)-1-[(3,4-dimethoxyphenyl)methyl-propan-2-ylamino]-3-prop-2-ynoxypropan-2-ol |
| SMILES | C#CCOC[C@H](O)CN(Cc1ccc(OC)c(OC)c1)C(C)C |
| InChI | InChI=1S/C18H27NO4/c1-6-9-23-13-16(20)12-19(14(2)3)11-15-7-8-17(21-4)18(10-15)22-5/h1,7-8,10,14,16,20H,9,11-13H2,2-5H3/t16-/m1/s1 |
| InChIKey | MKKQXWWIHGGZOI-MRXNPFEDSA-N |
| XLogP | 1.92 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|