C21H30N2O4 — CID 93161388
(2S)-1-[benzyl(2-morpholin-4-ylethyl)amino]-3-(furan-2-ylmethoxy)propan-2-ol (PubChem CID 93161388) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is (2S)-1-[benzyl(2-morpholin-4-ylethyl)amino]-3-(furan-2-ylmethoxy)propan-2-ol.
| Compound Name | (2S)-1-[benzyl(2-morpholin-4-ylethyl)amino]-3-(furan-2-ylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 93161388 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | (2S)-1-[benzyl(2-morpholin-4-ylethyl)amino]-3-(furan-2-ylmethoxy)propan-2-ol |
| SMILES | O[C@H](COCc1ccco1)CN(CCN1CCOCC1)Cc1ccccc1 |
| InChI | InChI=1S/C21H30N2O4/c24-20(17-26-18-21-7-4-12-27-21)16-23(15-19-5-2-1-3-6-19)9-8-22-10-13-25-14-11-22/h1-7,12,20,24H,8-11,13-18H2/t20-/m0/s1 |
| InChIKey | XPOQJWTUISTQOC-FQEVSTJZSA-N |
| XLogP | 1.99 |
| TPSA | 58.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |