C16H23NO3 — CID 93161975
(2S)-1-[cyclopropylmethyl-[(5-methylfuran-2-yl)methyl]amino]-3-prop-2-ynoxypropan-2-ol (PubChem CID 93161975) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is (2S)-1-[cyclopropylmethyl-[(5-methylfuran-2-yl)methyl]amino]-3-prop-2-ynoxypropan-2-ol.
| Compound Name | (2S)-1-[cyclopropylmethyl-[(5-methylfuran-2-yl)methyl]amino]-3-prop-2-ynoxypropan-2-ol |
|---|---|
| PubChem CID | 93161975 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | (2S)-1-[cyclopropylmethyl-[(5-methylfuran-2-yl)methyl]amino]-3-prop-2-ynoxypropan-2-ol |
| SMILES | C#CCOC[C@@H](O)CN(Cc1ccc(C)o1)CC1CC1 |
| InChI | InChI=1S/C16H23NO3/c1-3-8-19-12-15(18)10-17(9-14-5-6-14)11-16-7-4-13(2)20-16/h1,4,7,14-15,18H,5-6,8-12H2,2H3/t15-/m0/s1 |
| InChIKey | LIETXEDWQOGUHL-HNNXBMFYSA-N |
| XLogP | 1.81 |
| TPSA | 45.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|