C17H23NO2S — CID 93163298
(1R)-2-[2-methoxyethyl-[(5-methylthiophen-2-yl)methyl]amino]-1-phenylethanol (PubChem CID 93163298) has the molecular formula C17H23NO2S and a molecular weight of 305.44 g/mol. Its IUPAC name is (1R)-2-[2-methoxyethyl-[(5-methylthiophen-2-yl)methyl]amino]-1-phenylethanol.
| Compound Name | (1R)-2-[2-methoxyethyl-[(5-methylthiophen-2-yl)methyl]amino]-1-phenylethanol |
|---|---|
| PubChem CID | 93163298 |
| Molecular Formula | C17H23NO2S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (1R)-2-[2-methoxyethyl-[(5-methylthiophen-2-yl)methyl]amino]-1-phenylethanol |
| SMILES | COCCN(Cc1ccc(C)s1)C[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C17H23NO2S/c1-14-8-9-16(21-14)12-18(10-11-20-2)13-17(19)15-6-4-3-5-7-15/h3-9,17,19H,10-13H2,1-2H3/t17-/m0/s1 |
| InChIKey | WQWWYQGDJMYFBK-KRWDZBQOSA-N |
| XLogP | 3.24 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |