C18H25NOS — CID 93163253
(1R)-2-[2-methylpropyl-[(5-methylthiophen-2-yl)methyl]amino]-1-phenylethanol (PubChem CID 93163253) has the molecular formula C18H25NOS and a molecular weight of 303.47 g/mol. Its IUPAC name is (1R)-2-[2-methylpropyl-[(5-methylthiophen-2-yl)methyl]amino]-1-phenylethanol.
| Compound Name | (1R)-2-[2-methylpropyl-[(5-methylthiophen-2-yl)methyl]amino]-1-phenylethanol |
|---|---|
| PubChem CID | 93163253 |
| Molecular Formula | C18H25NOS |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | (1R)-2-[2-methylpropyl-[(5-methylthiophen-2-yl)methyl]amino]-1-phenylethanol |
| SMILES | Cc1ccc(CN(CC(C)C)C[C@H](O)c2ccccc2)s1 |
| InChI | InChI=1S/C18H25NOS/c1-14(2)11-19(12-17-10-9-15(3)21-17)13-18(20)16-7-5-4-6-8-16/h4-10,14,18,20H,11-13H2,1-3H3/t18-/m0/s1 |
| InChIKey | ZNGOGRBYNVWEIA-SFHVURJKSA-N |
| XLogP | 4.25 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |