C22H24FNOS — CID 93163617
(2R)-1-[(4-fluorophenyl)methyl-[(5-methylthiophen-2-yl)methyl]amino]-3-phenylpropan-2-ol (PubChem CID 93163617) has the molecular formula C22H24FNOS and a molecular weight of 369.51 g/mol. Its IUPAC name is (2R)-1-[(4-fluorophenyl)methyl-[(5-methylthiophen-2-yl)methyl]amino]-3-phenylpropan-2-ol.
| Compound Name | (2R)-1-[(4-fluorophenyl)methyl-[(5-methylthiophen-2-yl)methyl]amino]-3-phenylpropan-2-ol |
|---|---|
| PubChem CID | 93163617 |
| Molecular Formula | C22H24FNOS |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | (2R)-1-[(4-fluorophenyl)methyl-[(5-methylthiophen-2-yl)methyl]amino]-3-phenylpropan-2-ol |
| SMILES | Cc1ccc(CN(Cc2ccc(F)cc2)C[C@H](O)Cc2ccccc2)s1 |
| InChI | InChI=1S/C22H24FNOS/c1-17-7-12-22(26-17)16-24(14-19-8-10-20(23)11-9-19)15-21(25)13-18-5-3-2-4-6-18/h2-12,21,25H,13-16H2,1H3/t21-/m1/s1 |
| InChIKey | XQSZKPBIWCDYCT-OAQYLSRUSA-N |
| XLogP | 4.80 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |