C20H29NO2S — CID 46007466
1-(2-methylphenoxy)-3-[2-methylpropyl-[(5-methylthiophen-2-yl)methyl]amino]propan-2-ol (PubChem CID 46007466) has the molecular formula C20H29NO2S and a molecular weight of 347.52 g/mol. Its IUPAC name is 1-(2-methylphenoxy)-3-[2-methylpropyl-[(5-methylthiophen-2-yl)methyl]amino]propan-2-ol.
| Compound Name | 1-(2-methylphenoxy)-3-[2-methylpropyl-[(5-methylthiophen-2-yl)methyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 46007466 |
| Molecular Formula | C20H29NO2S |
| Molecular Weight | 347.52 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 1-(2-methylphenoxy)-3-[2-methylpropyl-[(5-methylthiophen-2-yl)methyl]amino]propan-2-ol |
| SMILES | Cc1ccc(CN(CC(C)C)CC(O)COc2ccccc2C)s1 |
| InChI | InChI=1S/C20H29NO2S/c1-15(2)11-21(13-19-10-9-17(4)24-19)12-18(22)14-23-20-8-6-5-7-16(20)3/h5-10,15,18,22H,11-14H2,1-4H3 |
| InChIKey | RKDBLTLAUUYWFF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.52 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |