C14H25NOS — CID 24714016
1-[2-methylpropyl-[(5-methylthiophen-2-yl)methyl]amino]butan-2-ol (PubChem CID 24714016) has the molecular formula C14H25NOS and a molecular weight of 255.43 g/mol. Its IUPAC name is 1-[2-methylpropyl-[(5-methylthiophen-2-yl)methyl]amino]butan-2-ol.
| Compound Name | 1-[2-methylpropyl-[(5-methylthiophen-2-yl)methyl]amino]butan-2-ol |
|---|---|
| PubChem CID | 24714016 |
| Molecular Formula | C14H25NOS |
| Molecular Weight | 255.43 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 1-[2-methylpropyl-[(5-methylthiophen-2-yl)methyl]amino]butan-2-ol |
| SMILES | CCC(O)CN(Cc1ccc(C)s1)CC(C)C |
| InChI | InChI=1S/C14H25NOS/c1-5-13(16)9-15(8-11(2)3)10-14-7-6-12(4)17-14/h6-7,11,13,16H,5,8-10H2,1-4H3 |
| InChIKey | ABVLZTCIRZZHKX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |