C41H46N2O5 — CID 10100730
2,6-bis[[bis[(2R)-2-hydroxy-2-phenylethyl]amino]methyl]-4-methylphenol (PubChem CID 10100730) has the molecular formula C41H46N2O5 and a molecular weight of 646.83 g/mol. Its IUPAC name is 2,6-bis[[bis[(2R)-2-hydroxy-2-phenylethyl]amino]methyl]-4-methylphenol.
| Compound Name | 2,6-bis[[bis[(2R)-2-hydroxy-2-phenylethyl]amino]methyl]-4-methylphenol |
|---|---|
| PubChem CID | 10100730 |
| Molecular Formula | C41H46N2O5 |
| Molecular Weight | 646.83 g/mol |
| Exact Mass | 646.34 |
| IUPAC Name | 2,6-bis[[bis[(2R)-2-hydroxy-2-phenylethyl]amino]methyl]-4-methylphenol |
| SMILES | Cc1cc(CN(C[C@H](O)c2ccccc2)C[C@H](O)c2ccccc2)c(O)c(CN(C[C@H](O)c2ccccc2)C[C@H](O)c2ccccc2)c1 |
| InChI | InChI=1S/C41H46N2O5/c1-30-22-35(24-42(26-37(44)31-14-6-2-7-15-31)27-38(45)32-16-8-3-9-17-32)41(48)36(23-30)25-43(28-39(46)33-18-10-4-11-19-33)29-40(47)34-20-12-5-13-21-34/h2-23,37-40,44-48H,24-29H2,1H3/t37-,38-,39-,40-/m0/s1 |
| InChIKey | CLXRPIGQNYPYJN-YKKXUYLKSA-N |
| XLogP | 6.24 |
| TPSA | 107.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.83 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|